C8H10BrNO2S2 — CID 79925933
5-bromo-N-cyclopropyl-4-methylthiophene-2-sulfonamide (PubChem CID 79925933) has the molecular formula C8H10BrNO2S2 and a molecular weight of 296.21 g/mol. Its IUPAC name is 5-bromo-N-cyclopropyl-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-cyclopropyl-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79925933 |
| Molecular Formula | C8H10BrNO2S2 |
| Molecular Weight | 296.21 g/mol |
| Exact Mass | 294.93 |
| IUPAC Name | 5-bromo-N-cyclopropyl-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CC2)sc1Br |
| InChI | InChI=1S/C8H10BrNO2S2/c1-5-4-7(13-8(5)9)14(11,12)10-6-2-3-6/h4,6,10H,2-3H2,1H3 |
| InChIKey | KEKHGNCLYKYKLW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.21 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |