C11H17BrN2O2S2 — CID 79988314
N-(4-aminocyclohexyl)-5-bromo-4-methylthiophene-2-sulfonamide (PubChem CID 79988314) has the molecular formula C11H17BrN2O2S2 and a molecular weight of 353.31 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-5-bromo-4-methylthiophene-2-sulfonamide.
| Compound Name | N-(4-aminocyclohexyl)-5-bromo-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 79988314 |
| Molecular Formula | C11H17BrN2O2S2 |
| Molecular Weight | 353.31 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | N-(4-aminocyclohexyl)-5-bromo-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CCC(N)CC2)sc1Br |
| InChI | InChI=1S/C11H17BrN2O2S2/c1-7-6-10(17-11(7)12)18(15,16)14-9-4-2-8(13)3-5-9/h6,8-9,14H,2-5,13H2,1H3 |
| InChIKey | VARVYLHBYUYUAE-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |