C12H16BrNO3S2 — CID 103864173
5-bromo-N-(2-cyclopropyloxolan-3-yl)-4-methylthiophene-2-sulfonamide (PubChem CID 103864173) has the molecular formula C12H16BrNO3S2 and a molecular weight of 366.30 g/mol. Its IUPAC name is 5-bromo-N-(2-cyclopropyloxolan-3-yl)-4-methylthiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(2-cyclopropyloxolan-3-yl)-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 103864173 |
| Molecular Formula | C12H16BrNO3S2 |
| Molecular Weight | 366.30 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | 5-bromo-N-(2-cyclopropyloxolan-3-yl)-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CCOC2C2CC2)sc1Br |
| InChI | InChI=1S/C12H16BrNO3S2/c1-7-6-10(18-12(7)13)19(15,16)14-9-4-5-17-11(9)8-2-3-8/h6,8-9,11,14H,2-5H2,1H3 |
| InChIKey | BHWVJYFCKYWQMK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |