C13H20N2O3S2 — CID 106092486
5-(aminomethyl)-N-(2-cyclopropyloxolan-3-yl)-2-methylthiophene-3-sulfonamide (PubChem CID 106092486) has the molecular formula C13H20N2O3S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 5-(aminomethyl)-N-(2-cyclopropyloxolan-3-yl)-2-methylthiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-N-(2-cyclopropyloxolan-3-yl)-2-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106092486 |
| Molecular Formula | C13H20N2O3S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 5-(aminomethyl)-N-(2-cyclopropyloxolan-3-yl)-2-methylthiophene-3-sulfonamide |
| SMILES | Cc1sc(CN)cc1S(=O)(=O)NC1CCOC1C1CC1 |
| InChI | InChI=1S/C13H20N2O3S2/c1-8-12(6-10(7-14)19-8)20(16,17)15-11-4-5-18-13(11)9-2-3-9/h6,9,11,13,15H,2-5,7,14H2,1H3 |
| InChIKey | QGYGFEYQLJJEEP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |