C13H22N2O2S3 — CID 106091372
5-(aminomethyl)-2-methyl-N-(3-methylsulfanylcyclohexyl)thiophene-3-sulfonamide (PubChem CID 106091372) has the molecular formula C13H22N2O2S3 and a molecular weight of 334.53 g/mol. Its IUPAC name is 5-(aminomethyl)-2-methyl-N-(3-methylsulfanylcyclohexyl)thiophene-3-sulfonamide.
| Compound Name | 5-(aminomethyl)-2-methyl-N-(3-methylsulfanylcyclohexyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106091372 |
| Molecular Formula | C13H22N2O2S3 |
| Molecular Weight | 334.53 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 5-(aminomethyl)-2-methyl-N-(3-methylsulfanylcyclohexyl)thiophene-3-sulfonamide |
| SMILES | CSC1CCCC(NS(=O)(=O)c2cc(CN)sc2C)C1 |
| InChI | InChI=1S/C13H22N2O2S3/c1-9-13(7-12(8-14)19-9)20(16,17)15-10-4-3-5-11(6-10)18-2/h7,10-11,15H,3-6,8,14H2,1-2H3 |
| InChIKey | LJFMJVOGBHYUAQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.53 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |