C14H24N2O2S3 — CID 106091389
5-[2-(methylamino)ethyl]-N-(3-methylsulfanylcyclohexyl)thiophene-2-sulfonamide (PubChem CID 106091389) has the molecular formula C14H24N2O2S3 and a molecular weight of 348.56 g/mol. Its IUPAC name is 5-[2-(methylamino)ethyl]-N-(3-methylsulfanylcyclohexyl)thiophene-2-sulfonamide.
| Compound Name | 5-[2-(methylamino)ethyl]-N-(3-methylsulfanylcyclohexyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106091389 |
| Molecular Formula | C14H24N2O2S3 |
| Molecular Weight | 348.56 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 5-[2-(methylamino)ethyl]-N-(3-methylsulfanylcyclohexyl)thiophene-2-sulfonamide |
| SMILES | CNCCc1ccc(S(=O)(=O)NC2CCCC(SC)C2)s1 |
| InChI | InChI=1S/C14H24N2O2S3/c1-15-9-8-12-6-7-14(20-12)21(17,18)16-11-4-3-5-13(10-11)19-2/h6-7,11,13,15-16H,3-5,8-10H2,1-2H3 |
| InChIKey | NQUXGGUNTFIMPN-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.56 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |