C9H11BrN2O3S2 — CID 104696894
5-bromo-4-methyl-N-(5-oxopyrrolidin-3-yl)thiophene-2-sulfonamide (PubChem CID 104696894) has the molecular formula C9H11BrN2O3S2 and a molecular weight of 339.24 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-(5-oxopyrrolidin-3-yl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-methyl-N-(5-oxopyrrolidin-3-yl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 104696894 |
| Molecular Formula | C9H11BrN2O3S2 |
| Molecular Weight | 339.24 g/mol |
| Exact Mass | 337.94 |
| IUPAC Name | 5-bromo-4-methyl-N-(5-oxopyrrolidin-3-yl)thiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CNC(=O)C2)sc1Br |
| InChI | InChI=1S/C9H11BrN2O3S2/c1-5-2-8(16-9(5)10)17(14,15)12-6-3-7(13)11-4-6/h2,6,12H,3-4H2,1H3,(H,11,13) |
| InChIKey | KXYSNUFUSMGFIX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.24 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |