C10H15BrN2O2S2 — CID 104982659
5-bromo-4-methyl-N-[(3S)-piperidin-3-yl]thiophene-2-sulfonamide (PubChem CID 104982659) has the molecular formula C10H15BrN2O2S2 and a molecular weight of 339.28 g/mol. Its IUPAC name is 5-bromo-4-methyl-N-[(3S)-piperidin-3-yl]thiophene-2-sulfonamide.
| Compound Name | 5-bromo-4-methyl-N-[(3S)-piperidin-3-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 104982659 |
| Molecular Formula | C10H15BrN2O2S2 |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 337.98 |
| IUPAC Name | 5-bromo-4-methyl-N-[(3S)-piperidin-3-yl]thiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N[C@H]2CCCNC2)sc1Br |
| InChI | InChI=1S/C10H15BrN2O2S2/c1-7-5-9(16-10(7)11)17(14,15)13-8-3-2-4-12-6-8/h5,8,12-13H,2-4,6H2,1H3/t8-/m0/s1 |
| InChIKey | XKECKSXVPWDPBQ-QMMMGPOBSA-N |
| XLogP | 1.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |