C10H16N2O2S2 — CID 84597452
4,5-dimethyl-N-pyrrolidin-3-ylthiophene-2-sulfonamide (PubChem CID 84597452) has the molecular formula C10H16N2O2S2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 4,5-dimethyl-N-pyrrolidin-3-ylthiophene-2-sulfonamide.
| Compound Name | 4,5-dimethyl-N-pyrrolidin-3-ylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 84597452 |
| Molecular Formula | C10H16N2O2S2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | 4,5-dimethyl-N-pyrrolidin-3-ylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NC2CCNC2)sc1C |
| InChI | InChI=1S/C10H16N2O2S2/c1-7-5-10(15-8(7)2)16(13,14)12-9-3-4-11-6-9/h5,9,11-12H,3-4,6H2,1-2H3 |
| InChIKey | MBRADMDSTGOXPP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |