C20H23BrFN3O3S — CID 60508186
N-(4-bromophenyl)-3-[4-[(4-fluorophenyl)sulfonylamino]piperidin-1-yl]propanamide (PubChem CID 60508186) has the molecular formula C20H23BrFN3O3S and a molecular weight of 484.39 g/mol. Its IUPAC name is N-(4-bromophenyl)-3-[4-[(4-fluorophenyl)sulfonylamino]piperidin-1-yl]propanamide.
| Compound Name | N-(4-bromophenyl)-3-[4-[(4-fluorophenyl)sulfonylamino]piperidin-1-yl]propanamide |
|---|---|
| PubChem CID | 60508186 |
| Molecular Formula | C20H23BrFN3O3S |
| Molecular Weight | 484.39 g/mol |
| Exact Mass | 483.06 |
| IUPAC Name | N-(4-bromophenyl)-3-[4-[(4-fluorophenyl)sulfonylamino]piperidin-1-yl]propanamide |
| SMILES | O=C(CCN1CCC(NS(=O)(=O)c2ccc(F)cc2)CC1)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C20H23BrFN3O3S/c21-15-1-5-17(6-2-15)23-20(26)11-14-25-12-9-18(10-13-25)24-29(27,28)19-7-3-16(22)4-8-19/h1-8,18,24H,9-14H2,(H,23,26) |
| InChIKey | DHMDOLJIKWTAEB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |