C16H23BrN2O4S — CID 139613526
6-[3-[(4-bromophenyl)sulfonylamino]pyrrolidin-1-yl]hexanoic acid (PubChem CID 139613526) has the molecular formula C16H23BrN2O4S and a molecular weight of 419.34 g/mol. Its IUPAC name is 6-[3-[(4-bromophenyl)sulfonylamino]pyrrolidin-1-yl]hexanoic acid.
| Compound Name | 6-[3-[(4-bromophenyl)sulfonylamino]pyrrolidin-1-yl]hexanoic acid |
|---|---|
| PubChem CID | 139613526 |
| Molecular Formula | C16H23BrN2O4S |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 6-[3-[(4-bromophenyl)sulfonylamino]pyrrolidin-1-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1CCC(NS(=O)(=O)c2ccc(Br)cc2)C1 |
| InChI | InChI=1S/C16H23BrN2O4S/c17-13-5-7-15(8-6-13)24(22,23)18-14-9-11-19(12-14)10-3-1-2-4-16(20)21/h5-8,14,18H,1-4,9-12H2,(H,20,21) |
| InChIKey | ULCBGBXKZARKHQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|