C16H21ClN2O5S — CID 139613468
5-[4-[(4-chlorophenyl)sulfonylamino]piperidin-1-yl]-5-oxopentanoic acid (PubChem CID 139613468) has the molecular formula C16H21ClN2O5S and a molecular weight of 388.87 g/mol. Its IUPAC name is 5-[4-[(4-chlorophenyl)sulfonylamino]piperidin-1-yl]-5-oxopentanoic acid.
| Compound Name | 5-[4-[(4-chlorophenyl)sulfonylamino]piperidin-1-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 139613468 |
| Molecular Formula | C16H21ClN2O5S |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.09 |
| IUPAC Name | 5-[4-[(4-chlorophenyl)sulfonylamino]piperidin-1-yl]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)N1CCC(NS(=O)(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H21ClN2O5S/c17-12-4-6-14(7-5-12)25(23,24)18-13-8-10-19(11-9-13)15(20)2-1-3-16(21)22/h4-7,13,18H,1-3,8-11H2,(H,21,22) |
| InChIKey | NGDHTLPHFNXPKH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |