C20H22ClFN2O3S2 — CID 34346590
N-[1-[3-(4-chlorophenyl)sulfanylpropanoyl]piperidin-4-yl]-4-fluorobenzenesulfonamide (PubChem CID 34346590) has the molecular formula C20H22ClFN2O3S2 and a molecular weight of 456.99 g/mol. Its IUPAC name is N-[1-[3-(4-chlorophenyl)sulfanylpropanoyl]piperidin-4-yl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[1-[3-(4-chlorophenyl)sulfanylpropanoyl]piperidin-4-yl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 34346590 |
| Molecular Formula | C20H22ClFN2O3S2 |
| Molecular Weight | 456.99 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | N-[1-[3-(4-chlorophenyl)sulfanylpropanoyl]piperidin-4-yl]-4-fluorobenzenesulfonamide |
| SMILES | O=C(CCSc1ccc(Cl)cc1)N1CCC(NS(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H22ClFN2O3S2/c21-15-1-5-18(6-2-15)28-14-11-20(25)24-12-9-17(10-13-24)23-29(26,27)19-7-3-16(22)4-8-19/h1-8,17,23H,9-14H2 |
| InChIKey | CLLIOEAIMSZUNU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.99 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |