C17H24FN3O3S — CID 119732715
4-fluoro-N-[1-(2-pyrrolidin-2-ylacetyl)piperidin-4-yl]benzenesulfonamide (PubChem CID 119732715) has the molecular formula C17H24FN3O3S and a molecular weight of 369.46 g/mol. Its IUPAC name is 4-fluoro-N-[1-(2-pyrrolidin-2-ylacetyl)piperidin-4-yl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[1-(2-pyrrolidin-2-ylacetyl)piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 119732715 |
| Molecular Formula | C17H24FN3O3S |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 4-fluoro-N-[1-(2-pyrrolidin-2-ylacetyl)piperidin-4-yl]benzenesulfonamide |
| SMILES | O=C(CC1CCCN1)N1CCC(NS(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H24FN3O3S/c18-13-3-5-16(6-4-13)25(23,24)20-14-7-10-21(11-8-14)17(22)12-15-2-1-9-19-15/h3-6,14-15,19-20H,1-2,7-12H2 |
| InChIKey | GDIGRIOLKLJXFZ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |