C20H20F4N2O4S — CID 60511265
4-fluoro-N-[1-[2-[4-(trifluoromethyl)phenoxy]acetyl]piperidin-4-yl]benzenesulfonamide (PubChem CID 60511265) has the molecular formula C20H20F4N2O4S and a molecular weight of 460.45 g/mol. Its IUPAC name is 4-fluoro-N-[1-[2-[4-(trifluoromethyl)phenoxy]acetyl]piperidin-4-yl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[1-[2-[4-(trifluoromethyl)phenoxy]acetyl]piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 60511265 |
| Molecular Formula | C20H20F4N2O4S |
| Molecular Weight | 460.45 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | 4-fluoro-N-[1-[2-[4-(trifluoromethyl)phenoxy]acetyl]piperidin-4-yl]benzenesulfonamide |
| SMILES | O=C(COc1ccc(C(F)(F)F)cc1)N1CCC(NS(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C20H20F4N2O4S/c21-15-3-7-18(8-4-15)31(28,29)25-16-9-11-26(12-10-16)19(27)13-30-17-5-1-14(2-6-17)20(22,23)24/h1-8,16,25H,9-13H2 |
| InChIKey | RYRWYRVOBJRWSZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.45 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |