C19H27N3O5S — CID 6491970
1-[2-[4-(cyclopentylsulfamoyl)phenoxy]acetyl]piperidine-4-carboxamide (PubChem CID 6491970) has the molecular formula C19H27N3O5S and a molecular weight of 409.51 g/mol. Its IUPAC name is 1-[2-[4-(cyclopentylsulfamoyl)phenoxy]acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-[4-(cyclopentylsulfamoyl)phenoxy]acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 6491970 |
| Molecular Formula | C19H27N3O5S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 1-[2-[4-(cyclopentylsulfamoyl)phenoxy]acetyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)COc2ccc(S(=O)(=O)NC3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C19H27N3O5S/c20-19(24)14-9-11-22(12-10-14)18(23)13-27-16-5-7-17(8-6-16)28(25,26)21-15-3-1-2-4-15/h5-8,14-15,21H,1-4,9-13H2,(H2,20,24) |
| InChIKey | HPESXNPAYCSWLL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |