C16H18F3NO4 — CID 84603993
methyl 1-[2-[4-(trifluoromethyl)phenoxy]acetyl]piperidine-4-carboxylate (PubChem CID 84603993) has the molecular formula C16H18F3NO4 and a molecular weight of 345.32 g/mol. Its IUPAC name is methyl 1-[2-[4-(trifluoromethyl)phenoxy]acetyl]piperidine-4-carboxylate.
| Compound Name | methyl 1-[2-[4-(trifluoromethyl)phenoxy]acetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 84603993 |
| Molecular Formula | C16H18F3NO4 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | methyl 1-[2-[4-(trifluoromethyl)phenoxy]acetyl]piperidine-4-carboxylate |
| SMILES | COC(=O)C1CCN(C(=O)COc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H18F3NO4/c1-23-15(22)11-6-8-20(9-7-11)14(21)10-24-13-4-2-12(3-5-13)16(17,18)19/h2-5,11H,6-10H2,1H3 |
| InChIKey | NTYFALLLVGWSCN-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |