C15H19F3N2O2 — CID 124613081
1-[(3R)-3-(methylaminomethyl)pyrrolidin-1-yl]-2-[4-(trifluoromethyl)phenoxy]ethanone (PubChem CID 124613081) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is 1-[(3R)-3-(methylaminomethyl)pyrrolidin-1-yl]-2-[4-(trifluoromethyl)phenoxy]ethanone.
| Compound Name | 1-[(3R)-3-(methylaminomethyl)pyrrolidin-1-yl]-2-[4-(trifluoromethyl)phenoxy]ethanone |
|---|---|
| PubChem CID | 124613081 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 1-[(3R)-3-(methylaminomethyl)pyrrolidin-1-yl]-2-[4-(trifluoromethyl)phenoxy]ethanone |
| SMILES | CNC[C@H]1CCN(C(=O)COc2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C15H19F3N2O2/c1-19-8-11-6-7-20(9-11)14(21)10-22-13-4-2-12(3-5-13)15(16,17)18/h2-5,11,19H,6-10H2,1H3/t11-/m1/s1 |
| InChIKey | YTBGBTHCCUTFPL-LLVKDONJSA-N |
| XLogP | 2.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |