C22H28F3NO4 — CID 164906069
ethane;2-[4-(hydroxymethyl)phenoxy]-1-pyrrolidin-1-ylethanone;4-(trifluoromethyl)phenol (PubChem CID 164906069) has the molecular formula C22H28F3NO4 and a molecular weight of 427.46 g/mol. Its IUPAC name is ethane;2-[4-(hydroxymethyl)phenoxy]-1-pyrrolidin-1-ylethanone;4-(trifluoromethyl)phenol.
| Compound Name | ethane;2-[4-(hydroxymethyl)phenoxy]-1-pyrrolidin-1-ylethanone;4-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 164906069 |
| Molecular Formula | C22H28F3NO4 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | ethane;2-[4-(hydroxymethyl)phenoxy]-1-pyrrolidin-1-ylethanone;4-(trifluoromethyl)phenol |
| SMILES | CC.O=C(COc1ccc(CO)cc1)N1CCCC1.Oc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H17NO3.C7H5F3O.C2H6/c15-9-11-3-5-12(6-4-11)17-10-13(16)14-7-1-2-8-14;8-7(9,10)5-1-3-6(11)4-2-5;1-2/h3-6,15H,1-2,7-10H2;1-4,11H;1-2H3 |
| InChIKey | RIQYJXVAURQVCX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |