C20H22F3NO5 — CID 164905979
2-[4-(hydroxymethyl)phenoxy]-1-pyrrolidin-1-ylethanone;2-(trifluoromethoxy)phenol (PubChem CID 164905979) has the molecular formula C20H22F3NO5 and a molecular weight of 413.39 g/mol. Its IUPAC name is 2-[4-(hydroxymethyl)phenoxy]-1-pyrrolidin-1-ylethanone;2-(trifluoromethoxy)phenol.
| Compound Name | 2-[4-(hydroxymethyl)phenoxy]-1-pyrrolidin-1-ylethanone;2-(trifluoromethoxy)phenol |
|---|---|
| PubChem CID | 164905979 |
| Molecular Formula | C20H22F3NO5 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | 2-[4-(hydroxymethyl)phenoxy]-1-pyrrolidin-1-ylethanone;2-(trifluoromethoxy)phenol |
| SMILES | O=C(COc1ccc(CO)cc1)N1CCCC1.Oc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H17NO3.C7H5F3O2/c15-9-11-3-5-12(6-4-11)17-10-13(16)14-7-1-2-8-14;8-7(9,10)12-6-4-2-1-3-5(6)11/h3-6,15H,1-2,7-10H2;1-4,11H |
| InChIKey | IASVDJVEZRFZSP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |