C18H26FN3O4S — CID 55960755
N-[2-[4-[(4-fluorophenyl)sulfonylamino]piperidin-1-yl]-2-oxoethyl]-2-methylbutanamide (PubChem CID 55960755) has the molecular formula C18H26FN3O4S and a molecular weight of 399.49 g/mol. Its IUPAC name is N-[2-[4-[(4-fluorophenyl)sulfonylamino]piperidin-1-yl]-2-oxoethyl]-2-methylbutanamide.
| Compound Name | N-[2-[4-[(4-fluorophenyl)sulfonylamino]piperidin-1-yl]-2-oxoethyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 55960755 |
| Molecular Formula | C18H26FN3O4S |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | N-[2-[4-[(4-fluorophenyl)sulfonylamino]piperidin-1-yl]-2-oxoethyl]-2-methylbutanamide |
| SMILES | CCC(C)C(=O)NCC(=O)N1CCC(NS(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H26FN3O4S/c1-3-13(2)18(24)20-12-17(23)22-10-8-15(9-11-22)21-27(25,26)16-6-4-14(19)5-7-16/h4-7,13,15,21H,3,8-12H2,1-2H3,(H,20,24) |
| InChIKey | VEQXVCQOIXGRAU-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |