C22H27N3O4S — CID 108564014
N-[2-[4-[(4-ethylphenyl)sulfonylamino]piperidin-1-yl]-2-oxoethyl]benzamide (PubChem CID 108564014) has the molecular formula C22H27N3O4S and a molecular weight of 429.54 g/mol. Its IUPAC name is N-[2-[4-[(4-ethylphenyl)sulfonylamino]piperidin-1-yl]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[4-[(4-ethylphenyl)sulfonylamino]piperidin-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 108564014 |
| Molecular Formula | C22H27N3O4S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | N-[2-[4-[(4-ethylphenyl)sulfonylamino]piperidin-1-yl]-2-oxoethyl]benzamide |
| SMILES | CCc1ccc(S(=O)(=O)NC2CCN(C(=O)CNC(=O)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C22H27N3O4S/c1-2-17-8-10-20(11-9-17)30(28,29)24-19-12-14-25(15-13-19)21(26)16-23-22(27)18-6-4-3-5-7-18/h3-11,19,24H,2,12-16H2,1H3,(H,23,27) |
| InChIKey | CSSNLWHMWYEQPB-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |