C16H21N3O4 — CID 110821590
methyl N-[1-(2-benzamidoacetyl)piperidin-4-yl]carbamate (PubChem CID 110821590) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is methyl N-[1-(2-benzamidoacetyl)piperidin-4-yl]carbamate.
| Compound Name | methyl N-[1-(2-benzamidoacetyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 110821590 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | methyl N-[1-(2-benzamidoacetyl)piperidin-4-yl]carbamate |
| SMILES | COC(=O)NC1CCN(C(=O)CNC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C16H21N3O4/c1-23-16(22)18-13-7-9-19(10-8-13)14(20)11-17-15(21)12-5-3-2-4-6-12/h2-6,13H,7-11H2,1H3,(H,17,21)(H,18,22) |
| InChIKey | NVMZGXNHJMMVEE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |