C20H25N3O2 — CID 110743431
N-[2-[4-(2,5-dimethylpyrrol-1-yl)piperidin-1-yl]-2-oxoethyl]benzamide (PubChem CID 110743431) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is N-[2-[4-(2,5-dimethylpyrrol-1-yl)piperidin-1-yl]-2-oxoethyl]benzamide.
| Compound Name | N-[2-[4-(2,5-dimethylpyrrol-1-yl)piperidin-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 110743431 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | N-[2-[4-(2,5-dimethylpyrrol-1-yl)piperidin-1-yl]-2-oxoethyl]benzamide |
| SMILES | Cc1ccc(C)n1C1CCN(C(=O)CNC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H25N3O2/c1-15-8-9-16(2)23(15)18-10-12-22(13-11-18)19(24)14-21-20(25)17-6-4-3-5-7-17/h3-9,18H,10-14H2,1-2H3,(H,21,25) |
| InChIKey | ZXMFHFWYVUKGJN-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |