C17H23N3O4 — CID 47932223
ethyl N-[1-(2-benzamidoacetyl)piperidin-4-yl]carbamate (PubChem CID 47932223) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is ethyl N-[1-(2-benzamidoacetyl)piperidin-4-yl]carbamate.
| Compound Name | ethyl N-[1-(2-benzamidoacetyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 47932223 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | ethyl N-[1-(2-benzamidoacetyl)piperidin-4-yl]carbamate |
| SMILES | CCOC(=O)NC1CCN(C(=O)CNC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H23N3O4/c1-2-24-17(23)19-14-8-10-20(11-9-14)15(21)12-18-16(22)13-6-4-3-5-7-13/h3-7,14H,2,8-12H2,1H3,(H,18,22)(H,19,23) |
| InChIKey | CAMAVHKTCDGPJB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |