C16H23ClN2OS — CID 119560247
4-(4-chlorophenyl)sulfanyl-1-[4-(methylamino)piperidin-1-yl]butan-1-one (PubChem CID 119560247) has the molecular formula C16H23ClN2OS and a molecular weight of 326.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-1-[4-(methylamino)piperidin-1-yl]butan-1-one.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-1-[4-(methylamino)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 119560247 |
| Molecular Formula | C16H23ClN2OS |
| Molecular Weight | 326.89 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-1-[4-(methylamino)piperidin-1-yl]butan-1-one |
| SMILES | CNC1CCN(C(=O)CCCSc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H23ClN2OS/c1-18-14-8-10-19(11-9-14)16(20)3-2-12-21-15-6-4-13(17)5-7-15/h4-7,14,18H,2-3,8-12H2,1H3 |
| InChIKey | RODDFIDXFGXXDV-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.89 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|