C22H25ClN2O2S — CID 24575407
N-[1-[4-(4-chlorophenyl)sulfanylbutanoyl]piperidin-4-yl]benzamide (PubChem CID 24575407) has the molecular formula C22H25ClN2O2S and a molecular weight of 416.97 g/mol. Its IUPAC name is N-[1-[4-(4-chlorophenyl)sulfanylbutanoyl]piperidin-4-yl]benzamide.
| Compound Name | N-[1-[4-(4-chlorophenyl)sulfanylbutanoyl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 24575407 |
| Molecular Formula | C22H25ClN2O2S |
| Molecular Weight | 416.97 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-[1-[4-(4-chlorophenyl)sulfanylbutanoyl]piperidin-4-yl]benzamide |
| SMILES | O=C(NC1CCN(C(=O)CCCSc2ccc(Cl)cc2)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H25ClN2O2S/c23-18-8-10-20(11-9-18)28-16-4-7-21(26)25-14-12-19(13-15-25)24-22(27)17-5-2-1-3-6-17/h1-3,5-6,8-11,19H,4,7,12-16H2,(H,24,27) |
| InChIKey | RZDFVIBHOFAEFQ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.97 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|