C18H28Cl2N2OS — CID 119644684
4-(4-chlorophenyl)sulfanyl-1-[4-(ethylaminomethyl)piperidin-1-yl]butan-1-one;hydrochloride (PubChem CID 119644684) has the molecular formula C18H28Cl2N2OS and a molecular weight of 391.41 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-1-[4-(ethylaminomethyl)piperidin-1-yl]butan-1-one;hydrochloride.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-1-[4-(ethylaminomethyl)piperidin-1-yl]butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119644684 |
| Molecular Formula | C18H28Cl2N2OS |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 390.13 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-1-[4-(ethylaminomethyl)piperidin-1-yl]butan-1-one;hydrochloride |
| SMILES | CCNCC1CCN(C(=O)CCCSc2ccc(Cl)cc2)CC1.Cl |
| InChI | InChI=1S/C18H27ClN2OS.ClH/c1-2-20-14-15-9-11-21(12-10-15)18(22)4-3-13-23-17-7-5-16(19)6-8-17;/h5-8,15,20H,2-4,9-14H2,1H3;1H |
| InChIKey | WYEPBULBWJVCLZ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|