C16H24Cl2N2OS — CID 119488253
4-(4-chlorophenyl)sulfanyl-1-[3-(methylamino)piperidin-1-yl]butan-1-one;hydrochloride (PubChem CID 119488253) has the molecular formula C16H24Cl2N2OS and a molecular weight of 363.35 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-1-[3-(methylamino)piperidin-1-yl]butan-1-one;hydrochloride.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-1-[3-(methylamino)piperidin-1-yl]butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119488253 |
| Molecular Formula | C16H24Cl2N2OS |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-1-[3-(methylamino)piperidin-1-yl]butan-1-one;hydrochloride |
| SMILES | CNC1CCCN(C(=O)CCCSc2ccc(Cl)cc2)C1.Cl |
| InChI | InChI=1S/C16H23ClN2OS.ClH/c1-18-14-4-2-10-19(12-14)16(20)5-3-11-21-15-8-6-13(17)7-9-15;/h6-9,14,18H,2-5,10-12H2,1H3;1H |
| InChIKey | WFYROBCWVUCPHD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|