C14H29ClN2OS — CID 119645132
1-[4-(ethylaminomethyl)piperidin-1-yl]-5-methylsulfanylpentan-1-one;hydrochloride (PubChem CID 119645132) has the molecular formula C14H29ClN2OS and a molecular weight of 308.92 g/mol. Its IUPAC name is 1-[4-(ethylaminomethyl)piperidin-1-yl]-5-methylsulfanylpentan-1-one;hydrochloride.
| Compound Name | 1-[4-(ethylaminomethyl)piperidin-1-yl]-5-methylsulfanylpentan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119645132 |
| Molecular Formula | C14H29ClN2OS |
| Molecular Weight | 308.92 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 1-[4-(ethylaminomethyl)piperidin-1-yl]-5-methylsulfanylpentan-1-one;hydrochloride |
| SMILES | CCNCC1CCN(C(=O)CCCCSC)CC1.Cl |
| InChI | InChI=1S/C14H28N2OS.ClH/c1-3-15-12-13-7-9-16(10-8-13)14(17)6-4-5-11-18-2;/h13,15H,3-12H2,1-2H3;1H |
| InChIKey | WFCCVZJEQMXQFO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.92 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|