C18H26Cl2N2O2 — CID 119644834
4-(2,4-dichlorophenoxy)-1-[4-(ethylaminomethyl)piperidin-1-yl]butan-1-one (PubChem CID 119644834) has the molecular formula C18H26Cl2N2O2 and a molecular weight of 373.32 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-1-[4-(ethylaminomethyl)piperidin-1-yl]butan-1-one.
| Compound Name | 4-(2,4-dichlorophenoxy)-1-[4-(ethylaminomethyl)piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 119644834 |
| Molecular Formula | C18H26Cl2N2O2 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-1-[4-(ethylaminomethyl)piperidin-1-yl]butan-1-one |
| SMILES | CCNCC1CCN(C(=O)CCCOc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C18H26Cl2N2O2/c1-2-21-13-14-7-9-22(10-8-14)18(23)4-3-11-24-17-6-5-15(19)12-16(17)20/h5-6,12,14,21H,2-4,7-11,13H2,1H3 |
| InChIKey | MEYUXOLEXUJCMP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|