C22H25Cl2NO2 — CID 3428823
1-(4-benzylpiperidin-1-yl)-4-(2,4-dichlorophenoxy)butan-1-one (PubChem CID 3428823) has the molecular formula C22H25Cl2NO2 and a molecular weight of 406.35 g/mol. Its IUPAC name is 1-(4-benzylpiperidin-1-yl)-4-(2,4-dichlorophenoxy)butan-1-one.
| Compound Name | 1-(4-benzylpiperidin-1-yl)-4-(2,4-dichlorophenoxy)butan-1-one |
|---|---|
| PubChem CID | 3428823 |
| Molecular Formula | C22H25Cl2NO2 |
| Molecular Weight | 406.35 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 1-(4-benzylpiperidin-1-yl)-4-(2,4-dichlorophenoxy)butan-1-one |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H25Cl2NO2/c23-19-8-9-21(20(24)16-19)27-14-4-7-22(26)25-12-10-18(11-13-25)15-17-5-2-1-3-6-17/h1-3,5-6,8-9,16,18H,4,7,10-15H2 |
| InChIKey | IINWCTIDIJTJQL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.35 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|