C22H23Cl2N3O2 — CID 35348225
1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-4-(2,4-dichlorophenoxy)butan-1-one (PubChem CID 35348225) has the molecular formula C22H23Cl2N3O2 and a molecular weight of 432.35 g/mol. Its IUPAC name is 1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-4-(2,4-dichlorophenoxy)butan-1-one.
| Compound Name | 1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-4-(2,4-dichlorophenoxy)butan-1-one |
|---|---|
| PubChem CID | 35348225 |
| Molecular Formula | C22H23Cl2N3O2 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 431.12 |
| IUPAC Name | 1-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-4-(2,4-dichlorophenoxy)butan-1-one |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)N1CCC(c2nc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C22H23Cl2N3O2/c23-16-7-8-20(17(24)14-16)29-13-3-6-21(28)27-11-9-15(10-12-27)22-25-18-4-1-2-5-19(18)26-22/h1-2,4-5,7-8,14-15H,3,6,9-13H2,(H,25,26) |
| InChIKey | CWDAENHNKNRQDX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|