C19H19Cl4N3O2 — CID 55808389
4-(2,4-dichlorophenoxy)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]butan-1-one (PubChem CID 55808389) has the molecular formula C19H19Cl4N3O2 and a molecular weight of 463.19 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]butan-1-one.
| Compound Name | 4-(2,4-dichlorophenoxy)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 55808389 |
| Molecular Formula | C19H19Cl4N3O2 |
| Molecular Weight | 463.19 g/mol |
| Exact Mass | 461.02 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-1-[4-(3,5-dichloro-2-pyridinyl)piperazin-1-yl]butan-1-one |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)N1CCN(c2ncc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C19H19Cl4N3O2/c20-13-3-4-17(15(22)10-13)28-9-1-2-18(27)25-5-7-26(8-6-25)19-16(23)11-14(21)12-24-19/h3-4,10-12H,1-2,5-9H2 |
| InChIKey | BJKJHHMPSZQMEH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.19 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|