C17H22Cl2N2O2 — CID 17147320
4-(2,4-dichlorophenoxy)-1-(4-prop-2-enylpiperazin-1-yl)butan-1-one (PubChem CID 17147320) has the molecular formula C17H22Cl2N2O2 and a molecular weight of 357.28 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-1-(4-prop-2-enylpiperazin-1-yl)butan-1-one.
| Compound Name | 4-(2,4-dichlorophenoxy)-1-(4-prop-2-enylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 17147320 |
| Molecular Formula | C17H22Cl2N2O2 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-1-(4-prop-2-enylpiperazin-1-yl)butan-1-one |
| SMILES | C=CCN1CCN(C(=O)CCCOc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C17H22Cl2N2O2/c1-2-7-20-8-10-21(11-9-20)17(22)4-3-12-23-16-6-5-14(18)13-15(16)19/h2,5-6,13H,1,3-4,7-12H2 |
| InChIKey | ODKSEIRYEAXCOV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|