C23H22Cl3NO4 — CID 108735075
6-chloro-1'-[4-(2,4-dichlorophenoxy)butanoyl]spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108735075) has the molecular formula C23H22Cl3NO4 and a molecular weight of 482.79 g/mol. Its IUPAC name is 6-chloro-1'-[4-(2,4-dichlorophenoxy)butanoyl]spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-chloro-1'-[4-(2,4-dichlorophenoxy)butanoyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108735075 |
| Molecular Formula | C23H22Cl3NO4 |
| Molecular Weight | 482.79 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | 6-chloro-1'-[4-(2,4-dichlorophenoxy)butanoyl]spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | O=C1CC2(CCN(C(=O)CCCOc3ccc(Cl)cc3Cl)CC2)Oc2ccc(Cl)cc21 |
| InChI | InChI=1S/C23H22Cl3NO4/c24-15-3-5-20-17(12-15)19(28)14-23(31-20)7-9-27(10-8-23)22(29)2-1-11-30-21-6-4-16(25)13-18(21)26/h3-6,12-13H,1-2,7-11,14H2 |
| InChIKey | HUEPVWXPNQEXRS-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.79 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|