C25H28ClNO5 — CID 108758509
6-chloro-1'-[4-(4-methoxyphenoxy)butanoyl]-7-methylspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108758509) has the molecular formula C25H28ClNO5 and a molecular weight of 457.95 g/mol. Its IUPAC name is 6-chloro-1'-[4-(4-methoxyphenoxy)butanoyl]-7-methylspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-chloro-1'-[4-(4-methoxyphenoxy)butanoyl]-7-methylspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108758509 |
| Molecular Formula | C25H28ClNO5 |
| Molecular Weight | 457.95 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | 6-chloro-1'-[4-(4-methoxyphenoxy)butanoyl]-7-methylspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | COc1ccc(OCCCC(=O)N2CCC3(CC2)CC(=O)c2cc(Cl)c(C)cc2O3)cc1 |
| InChI | InChI=1S/C25H28ClNO5/c1-17-14-23-20(15-21(17)26)22(28)16-25(32-23)9-11-27(12-10-25)24(29)4-3-13-31-19-7-5-18(30-2)6-8-19/h5-8,14-15H,3-4,9-13,16H2,1-2H3 |
| InChIKey | WAWWZQOTMHQLPM-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.95 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|