C28H29NO4 — CID 108757875
6-methyl-1'-(4-naphthalen-2-yloxybutanoyl)spiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108757875) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is 6-methyl-1'-(4-naphthalen-2-yloxybutanoyl)spiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-methyl-1'-(4-naphthalen-2-yloxybutanoyl)spiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108757875 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 6-methyl-1'-(4-naphthalen-2-yloxybutanoyl)spiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cc1ccc2c(c1)C(=O)CC1(CCN(C(=O)CCCOc3ccc4ccccc4c3)CC1)O2 |
| InChI | InChI=1S/C28H29NO4/c1-20-8-11-26-24(17-20)25(30)19-28(33-26)12-14-29(15-13-28)27(31)7-4-16-32-23-10-9-21-5-2-3-6-22(21)18-23/h2-3,5-6,8-11,17-18H,4,7,12-16,19H2,1H3 |
| InChIKey | YAVWYNOKVWYBLP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|