C25H28ClNO4 — CID 108762595
1'-[4-(4-chlorophenoxy)butanoyl]-5,7-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108762595) has the molecular formula C25H28ClNO4 and a molecular weight of 441.96 g/mol. Its IUPAC name is 1'-[4-(4-chlorophenoxy)butanoyl]-5,7-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-[4-(4-chlorophenoxy)butanoyl]-5,7-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108762595 |
| Molecular Formula | C25H28ClNO4 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 1'-[4-(4-chlorophenoxy)butanoyl]-5,7-dimethylspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | Cc1cc(C)c2c(c1)OC1(CCN(C(=O)CCCOc3ccc(Cl)cc3)CC1)CC2=O |
| InChI | InChI=1S/C25H28ClNO4/c1-17-14-18(2)24-21(28)16-25(31-22(24)15-17)9-11-27(12-10-25)23(29)4-3-13-30-20-7-5-19(26)6-8-20/h5-8,14-15H,3-4,9-13,16H2,1-2H3 |
| InChIKey | DCUYZTMGQSQLRE-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|