C18H23NO4 — CID 108735814
1'-butanoyl-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108735814) has the molecular formula C18H23NO4 and a molecular weight of 317.39 g/mol. Its IUPAC name is 1'-butanoyl-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-butanoyl-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108735814 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | 1'-butanoyl-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | CCCC(=O)N1CCC2(CC1)CC(=O)c1ccc(OC)cc1O2 |
| InChI | InChI=1S/C18H23NO4/c1-3-4-17(21)19-9-7-18(8-10-19)12-15(20)14-6-5-13(22-2)11-16(14)23-18/h5-6,11H,3-4,7-10,12H2,1-2H3 |
| InChIKey | ZXJLWIWVKUUVOB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |