C16H18ClNO4 — CID 108735805
1'-(2-chloroacetyl)-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 108735805) has the molecular formula C16H18ClNO4 and a molecular weight of 323.78 g/mol. Its IUPAC name is 1'-(2-chloroacetyl)-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-(2-chloroacetyl)-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 108735805 |
| Molecular Formula | C16H18ClNO4 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 1'-(2-chloroacetyl)-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | COc1ccc2c(c1)OC1(CCN(C(=O)CCl)CC1)CC2=O |
| InChI | InChI=1S/C16H18ClNO4/c1-21-11-2-3-12-13(19)9-16(22-14(12)8-11)4-6-18(7-5-16)15(20)10-17/h2-3,8H,4-7,9-10H2,1H3 |
| InChIKey | YYJYTGYAOPPLLQ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|