C16H21NO5S — CID 100759723
1'-ethylsulfonyl-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 100759723) has the molecular formula C16H21NO5S and a molecular weight of 339.41 g/mol. Its IUPAC name is 1'-ethylsulfonyl-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 1'-ethylsulfonyl-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 100759723 |
| Molecular Formula | C16H21NO5S |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 1'-ethylsulfonyl-7-methoxyspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | CCS(=O)(=O)N1CCC2(CC1)CC(=O)c1ccc(OC)cc1O2 |
| InChI | InChI=1S/C16H21NO5S/c1-3-23(19,20)17-8-6-16(7-9-17)11-14(18)13-5-4-12(21-2)10-15(13)22-16/h4-5,10H,3,6-9,11H2,1-2H3 |
| InChIKey | DJRUASKJURBXRG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |