C19H27NO4S — CID 100759436
6-tert-butyl-1'-ethylsulfonylspiro[3H-chromene-2,4'-piperidine]-4-one (PubChem CID 100759436) has the molecular formula C19H27NO4S and a molecular weight of 365.50 g/mol. Its IUPAC name is 6-tert-butyl-1'-ethylsulfonylspiro[3H-chromene-2,4'-piperidine]-4-one.
| Compound Name | 6-tert-butyl-1'-ethylsulfonylspiro[3H-chromene-2,4'-piperidine]-4-one |
|---|---|
| PubChem CID | 100759436 |
| Molecular Formula | C19H27NO4S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 6-tert-butyl-1'-ethylsulfonylspiro[3H-chromene-2,4'-piperidine]-4-one |
| SMILES | CCS(=O)(=O)N1CCC2(CC1)CC(=O)c1cc(C(C)(C)C)ccc1O2 |
| InChI | InChI=1S/C19H27NO4S/c1-5-25(22,23)20-10-8-19(9-11-20)13-16(21)15-12-14(18(2,3)4)6-7-17(15)24-19/h6-7,12H,5,8-11,13H2,1-4H3 |
| InChIKey | TVSFVMGDKJEUOS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |