C15H15NO6 — CID 66782544
4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid (PubChem CID 66782544) has the molecular formula C15H15NO6 and a molecular weight of 305.29 g/mol. Its IUPAC name is 4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid.
| Compound Name | 4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid |
|---|---|
| PubChem CID | 66782544 |
| Molecular Formula | C15H15NO6 |
| Molecular Weight | 305.29 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | 4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)CC1(CCN(C(=O)O)CC1)O2 |
| InChI | InChI=1S/C15H15NO6/c17-11-8-15(3-5-16(6-4-15)14(20)21)22-12-2-1-9(13(18)19)7-10(11)12/h1-2,7H,3-6,8H2,(H,18,19)(H,20,21) |
| InChIKey | OFZBNCWLGZVPII-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.29 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |