4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid

C15H15NO6 — CID 66782544

IUPAC4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid
SMILESO=C(O)c1ccc2c(c1)C(=O)CC1(CCN(C(=O)O)CC1)O2
InChIInChI=1S/C15H15NO6/c17-11-8-15(3-5-16(6-4-15)14(20)21)22-12-2-1-9(13(18)19)7-10(11)12/h1-2,7H,3-6,8H2,(H,18,19)(H,20,21)
InChIKeyOFZBNCWLGZVPII-UHFFFAOYSA-N
MW305.29 g/mol
LogP1.86
Rot. Bonds1

About 4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid

4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid (PubChem CID 66782544) has the molecular formula C15H15NO6 and a molecular weight of 305.29 g/mol. Its IUPAC name is 4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid.

Molecular Properties

Compound Name4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid
PubChem CID66782544
Molecular FormulaC15H15NO6
Molecular Weight305.29 g/mol
Exact Mass305.09
IUPAC Name4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid
SMILESO=C(O)c1ccc2c(c1)C(=O)CC1(CCN(C(=O)O)CC1)O2
InChIInChI=1S/C15H15NO6/c17-11-8-15(3-5-16(6-4-15)14(20)21)22-12-2-1-9(13(18)19)7-10(11)12/h1-2,7H,3-6,8H2,(H,18,19)(H,20,21)
InChIKeyOFZBNCWLGZVPII-UHFFFAOYSA-N
XLogP1.86
TPSA104.14 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500305.29
LogP ≤ 51.86
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid?
The IUPAC name of 4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid (CID 66782544) is 4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid.
What is the SMILES notation for 4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid?
The canonical SMILES for 4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid is O=C(O)c1ccc2c(c1)C(=O)CC1(CCN(C(=O)O)CC1)O2.
What is the InChIKey of 4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid?
The InChIKey is OFZBNCWLGZVPII-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO6/c17-11-8-15(3-5-16(6-4-15)14(20)21)22-12-2-1-9(13(18)19)7-10(11)12/h1-2,7H,3-6,8H2,(H,18,19)(H,20,21).
What are the key properties of 4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid?
4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid has a molecular weight of 305.29 g/mol, XLogP of 1.86, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxospiro[3H-chromene-2,4'-piperidine]-1',6-dicarboxylic acid is sourced from PubChem (CID 66782544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).