C23H23NO6 — CID 108735604
[4-(6-methoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl)phenyl] acetate (PubChem CID 108735604) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is [4-(6-methoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl)phenyl] acetate.
| Compound Name | [4-(6-methoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl)phenyl] acetate |
|---|---|
| PubChem CID | 108735604 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [4-(6-methoxy-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-carbonyl)phenyl] acetate |
| SMILES | COc1ccc2c(c1)C(=O)CC1(CCN(C(=O)c3ccc(OC(C)=O)cc3)CC1)O2 |
| InChI | InChI=1S/C23H23NO6/c1-15(25)29-17-5-3-16(4-6-17)22(27)24-11-9-23(10-12-24)14-20(26)19-13-18(28-2)7-8-21(19)30-23/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | BOUJCWQNCWLNHC-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|