C21H20N2O6 — CID 108746420
6-methoxy-1'-(3-methyl-4-nitrobenzoyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one (PubChem CID 108746420) has the molecular formula C21H20N2O6 and a molecular weight of 396.40 g/mol. Its IUPAC name is 6-methoxy-1'-(3-methyl-4-nitrobenzoyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one.
| Compound Name | 6-methoxy-1'-(3-methyl-4-nitrobenzoyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one |
|---|---|
| PubChem CID | 108746420 |
| Molecular Formula | C21H20N2O6 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 6-methoxy-1'-(3-methyl-4-nitrobenzoyl)spiro[3H-chromene-2,3'-pyrrolidine]-4-one |
| SMILES | COc1ccc2c(c1)C(=O)CC1(CCN(C(=O)c3ccc([N+](=O)[O-])c(C)c3)C1)O2 |
| InChI | InChI=1S/C21H20N2O6/c1-13-9-14(3-5-17(13)23(26)27)20(25)22-8-7-21(12-22)11-18(24)16-10-15(28-2)4-6-19(16)29-21/h3-6,9-10H,7-8,11-12H2,1-2H3 |
| InChIKey | YQWCJWYGEWSUHW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|