C25H23N3O8 — CID 108746404
2-[4-(6-methoxy-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-yl)-4-oxobutyl]-4-nitroisoindole-1,3-dione (PubChem CID 108746404) has the molecular formula C25H23N3O8 and a molecular weight of 493.47 g/mol. Its IUPAC name is 2-[4-(6-methoxy-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-yl)-4-oxobutyl]-4-nitroisoindole-1,3-dione.
| Compound Name | 2-[4-(6-methoxy-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-yl)-4-oxobutyl]-4-nitroisoindole-1,3-dione |
|---|---|
| PubChem CID | 108746404 |
| Molecular Formula | C25H23N3O8 |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 2-[4-(6-methoxy-4-oxospiro[3H-chromene-2,3'-pyrrolidine]-1'-yl)-4-oxobutyl]-4-nitroisoindole-1,3-dione |
| SMILES | COc1ccc2c(c1)C(=O)CC1(CCN(C(=O)CCCN3C(=O)c4cccc([N+](=O)[O-])c4C3=O)C1)O2 |
| InChI | InChI=1S/C25H23N3O8/c1-35-15-7-8-20-17(12-15)19(29)13-25(36-20)9-11-26(14-25)21(30)6-3-10-27-23(31)16-4-2-5-18(28(33)34)22(16)24(27)32/h2,4-5,7-8,12H,3,6,9-11,13-14H2,1H3 |
| InChIKey | BQOJBJLNAWQBPZ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 136.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|