C27H28N2O5 — CID 108758208
2-[4-(6,7-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-4-oxobutyl]isoindole-1,3-dione (PubChem CID 108758208) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is 2-[4-(6,7-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-4-oxobutyl]isoindole-1,3-dione.
| Compound Name | 2-[4-(6,7-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-4-oxobutyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108758208 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | 2-[4-(6,7-dimethyl-4-oxospiro[3H-chromene-2,4'-piperidine]-1'-yl)-4-oxobutyl]isoindole-1,3-dione |
| SMILES | Cc1cc2c(cc1C)C(=O)CC1(CCN(C(=O)CCCN3C(=O)c4ccccc4C3=O)CC1)O2 |
| InChI | InChI=1S/C27H28N2O5/c1-17-14-21-22(30)16-27(34-23(21)15-18(17)2)9-12-28(13-10-27)24(31)8-5-11-29-25(32)19-6-3-4-7-20(19)26(29)33/h3-4,6-7,14-15H,5,8-13,16H2,1-2H3 |
| InChIKey | CWSZYYWIQMVGIJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|