C31H28N2O4 — CID 108754045
2-[4-oxo-4-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)butyl]isoindole-1,3-dione (PubChem CID 108754045) has the molecular formula C31H28N2O4 and a molecular weight of 492.58 g/mol. Its IUPAC name is 2-[4-oxo-4-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-oxo-4-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108754045 |
| Molecular Formula | C31H28N2O4 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | 2-[4-oxo-4-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)butyl]isoindole-1,3-dione |
| SMILES | O=C(CCCN1C(=O)c2ccccc2C1=O)N1CCC2(C=Cc3cc(-c4ccccc4)ccc3O2)CC1 |
| InChI | InChI=1S/C31H28N2O4/c34-28(11-6-18-33-29(35)25-9-4-5-10-26(25)30(33)36)32-19-16-31(17-20-32)15-14-24-21-23(12-13-27(24)37-31)22-7-2-1-3-8-22/h1-5,7-10,12-15,21H,6,11,16-20H2 |
| InChIKey | UVWNUXCHIXJGAO-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|