C30H26N2O4 — CID 108754046
2-[3-oxo-3-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)propyl]isoindole-1,3-dione (PubChem CID 108754046) has the molecular formula C30H26N2O4 and a molecular weight of 478.55 g/mol. Its IUPAC name is 2-[3-oxo-3-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-oxo-3-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108754046 |
| Molecular Formula | C30H26N2O4 |
| Molecular Weight | 478.55 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-[3-oxo-3-(6-phenylspiro[chromene-2,4'-piperidine]-1'-yl)propyl]isoindole-1,3-dione |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)N1CCC2(C=Cc3cc(-c4ccccc4)ccc3O2)CC1 |
| InChI | InChI=1S/C30H26N2O4/c33-27(13-17-32-28(34)24-8-4-5-9-25(24)29(32)35)31-18-15-30(16-19-31)14-12-23-20-22(10-11-26(23)36-30)21-6-2-1-3-7-21/h1-12,14,20H,13,15-19H2 |
| InChIKey | SARRHJOCFBIRFU-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|